C50H37N5 — CID 176869704
1-[3-[3-[3-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]phenyl]benzenecarboximidoyl]-N-phenylnaphthalen-2-amine (PubChem CID 176869704) has the molecular formula C50H37N5 and a molecular weight of 707.88 g/mol. Its IUPAC name is 1-[3-[3-[3-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]phenyl]benzenecarboximidoyl]-N-phenylnaphthalen-2-amine.
| Compound Name | 1-[3-[3-[3-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]phenyl]benzenecarboximidoyl]-N-phenylnaphthalen-2-amine |
|---|---|
| PubChem CID | 176869704 |
| Molecular Formula | C50H37N5 |
| Molecular Weight | 707.88 g/mol |
| Exact Mass | 707.30 |
| IUPAC Name | 1-[3-[3-[3-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]phenyl]benzenecarboximidoyl]-N-phenylnaphthalen-2-amine |
| SMILES | [H]/N=C(\c1cccc(-c2cccc(-c3cccc(C4=NC(c5ccccc5)=NC(c5ccccc5)N4)c3)c2)c1)c1c(Nc2ccccc2)ccc2ccccc12 |
| InChI | InChI=1S/C50H37N5/c51-47(46-44-28-11-10-15-34(44)29-30-45(46)52-43-26-8-3-9-27-43)41-24-13-22-39(32-41)37-20-12-21-38(31-37)40-23-14-25-42(33-40)50-54-48(35-16-4-1-5-17-35)53-49(55-50)36-18-6-2-7-19-36/h1-33,48,51-52H,(H,53,54,55)/b51-47+ |
| InChIKey | LRZRQRPJDBGCEC-SBTUKGQASA-N |
| XLogP | 11.83 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.88 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|