C20H15BF4OS2 — CID 176904559
5-thianthren-5-ium-5-yl-2,3-dihydro-1-benzofuran tetrafluoroborate (PubChem CID 176904559) has the molecular formula C20H15BF4OS2 and a molecular weight of 422.28 g/mol. Its IUPAC name is 5-thianthren-5-ium-5-yl-2,3-dihydro-1-benzofuran tetrafluoroborate.
| Compound Name | 5-thianthren-5-ium-5-yl-2,3-dihydro-1-benzofuran tetrafluoroborate |
|---|---|
| PubChem CID | 176904559 |
| Molecular Formula | C20H15BF4OS2 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 5-thianthren-5-ium-5-yl-2,3-dihydro-1-benzofuran tetrafluoroborate |
| SMILES | F[B-](F)(F)F.c1ccc2c(c1)Sc1ccccc1[S+]2c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C20H15OS2.BF4/c1-3-7-19-17(5-1)22-18-6-2-4-8-20(18)23(19)15-9-10-16-14(13-15)11-12-21-16;2-1(3,4)5/h1-10,13H,11-12H2;/q+1;-1 |
| InChIKey | UGIQETZXYCMLFB-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|