C15H26F2N2 — CID 176922505
1-[(3Z)-4-(2,2-difluoroethyl)-5-methylocta-1,3-dien-2-yl]piperazine (PubChem CID 176922505) has the molecular formula C15H26F2N2 and a molecular weight of 272.38 g/mol. Its IUPAC name is 1-[(3Z)-4-(2,2-difluoroethyl)-5-methylocta-1,3-dien-2-yl]piperazine.
| Compound Name | 1-[(3Z)-4-(2,2-difluoroethyl)-5-methylocta-1,3-dien-2-yl]piperazine |
|---|---|
| PubChem CID | 176922505 |
| Molecular Formula | C15H26F2N2 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 1-[(3Z)-4-(2,2-difluoroethyl)-5-methylocta-1,3-dien-2-yl]piperazine |
| SMILES | C=C(/C=C(/CC(F)F)C(C)CCC)N1CCNCC1 |
| InChI | InChI=1S/C15H26F2N2/c1-4-5-12(2)14(11-15(16)17)10-13(3)19-8-6-18-7-9-19/h10,12,15,18H,3-9,11H2,1-2H3/b14-10- |
| InChIKey | WZYUHOJGHHFHOF-UVTDQMKNSA-N |
| XLogP | 3.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|