C16H28F2N2 — CID 176921275
1-[(3E,5Z)-6-(2,2-difluoroethyl)-7-methylnona-3,5-dien-4-yl]piperazine (PubChem CID 176921275) has the molecular formula C16H28F2N2 and a molecular weight of 286.41 g/mol. Its IUPAC name is 1-[(3E,5Z)-6-(2,2-difluoroethyl)-7-methylnona-3,5-dien-4-yl]piperazine.
| Compound Name | 1-[(3E,5Z)-6-(2,2-difluoroethyl)-7-methylnona-3,5-dien-4-yl]piperazine |
|---|---|
| PubChem CID | 176921275 |
| Molecular Formula | C16H28F2N2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | 1-[(3E,5Z)-6-(2,2-difluoroethyl)-7-methylnona-3,5-dien-4-yl]piperazine |
| SMILES | CC/C=C(\C=C(\CC(F)F)C(C)CC)N1CCNCC1 |
| InChI | InChI=1S/C16H28F2N2/c1-4-6-15(20-9-7-19-8-10-20)11-14(12-16(17)18)13(3)5-2/h6,11,13,16,19H,4-5,7-10,12H2,1-3H3/b14-11-,15-6+ |
| InChIKey | KMUYQZOJCQGDBW-JVKWYLOSSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|