C24H36ClFN6O — CID 176939410
N'-[7-chloro-5-ethyl-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-N-(3-methylbutyl)ethane-1,2-diamine (PubChem CID 176939410) has the molecular formula C24H36ClFN6O and a molecular weight of 479.04 g/mol. Its IUPAC name is N'-[7-chloro-5-ethyl-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-N-(3-methylbutyl)ethane-1,2-diamine.
| Compound Name | N'-[7-chloro-5-ethyl-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-N-(3-methylbutyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 176939410 |
| Molecular Formula | C24H36ClFN6O |
| Molecular Weight | 479.04 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | N'-[7-chloro-5-ethyl-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-N-(3-methylbutyl)ethane-1,2-diamine |
| SMILES | CCc1nc(Cl)c(F)c2nc(OCC34CCCN3CCC4)nc(NCCNCCC(C)C)c12 |
| InChI | InChI=1S/C24H36ClFN6O/c1-4-17-18-20(19(26)21(25)29-17)30-23(31-22(18)28-12-11-27-10-7-16(2)3)33-15-24-8-5-13-32(24)14-6-9-24/h16,27H,4-15H2,1-3H3,(H,28,30,31) |
| InChIKey | NBMZEAKRGRNHTH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.04 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|