C11H9FN2O2 — CID 176967670
3-[(3-fluorocyclohexa-1,3,4,5-tetraen-1-yl)amino]piperidine-2,6-dione (PubChem CID 176967670) has the molecular formula C11H9FN2O2 and a molecular weight of 220.20 g/mol. Its IUPAC name is 3-[(3-fluorocyclohexa-1,3,4,5-tetraen-1-yl)amino]piperidine-2,6-dione.
| Compound Name | 3-[(3-fluorocyclohexa-1,3,4,5-tetraen-1-yl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176967670 |
| Molecular Formula | C11H9FN2O2 |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 3-[(3-fluorocyclohexa-1,3,4,5-tetraen-1-yl)amino]piperidine-2,6-dione |
| SMILES | O=C1CCC(NC2=CC(F)=C=C=C2)C(=O)N1 |
| InChI | InChI=1S/C11H9FN2O2/c12-7-2-1-3-8(6-7)13-9-4-5-10(15)14-11(9)16/h3,6,9,13H,4-5H2,(H,14,15,16) |
| InChIKey | HMGZPFPVMHQUTR-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|