C13H12N2O4S2 — CID 176987099
6-[[(3R,6R)-6-hydroxy-2-oxa-7-thiabicyclo[4.1.0]heptan-3-yl]oxy]-1,3-benzothiazole-2-carboxamide (PubChem CID 176987099) has the molecular formula C13H12N2O4S2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 6-[[(3R,6R)-6-hydroxy-2-oxa-7-thiabicyclo[4.1.0]heptan-3-yl]oxy]-1,3-benzothiazole-2-carboxamide.
| Compound Name | 6-[[(3R,6R)-6-hydroxy-2-oxa-7-thiabicyclo[4.1.0]heptan-3-yl]oxy]-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 176987099 |
| Molecular Formula | C13H12N2O4S2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 6-[[(3R,6R)-6-hydroxy-2-oxa-7-thiabicyclo[4.1.0]heptan-3-yl]oxy]-1,3-benzothiazole-2-carboxamide |
| SMILES | NC(=O)c1nc2ccc(O[C@H]3CC[C@@]4(O)SC4O3)cc2s1 |
| InChI | InChI=1S/C13H12N2O4S2/c14-10(16)11-15-7-2-1-6(5-8(7)20-11)18-9-3-4-13(17)12(19-9)21-13/h1-2,5,9,12,17H,3-4H2,(H2,14,16)/t9-,12?,13-/m1/s1 |
| InChIKey | MJRLOBRAHVLTPJ-OCQGQDLMSA-N |
| XLogP | 1.67 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|