C26H26N2O2ReRf-2 — CID 177031342
1,4-bis(4-tert-butylphenyl)pyrrolo[3,4-c]pyrrole-2,5-diide-3,6-dione;rhenium;rutherfordium (PubChem CID 177031342) has the molecular formula C26H26N2O2ReRf-2 and a molecular weight of 851.71 g/mol. Its IUPAC name is 1,4-bis(4-tert-butylphenyl)pyrrolo[3,4-c]pyrrole-2,5-diide-3,6-dione;rhenium;rutherfordium.
| Compound Name | 1,4-bis(4-tert-butylphenyl)pyrrolo[3,4-c]pyrrole-2,5-diide-3,6-dione;rhenium;rutherfordium |
|---|---|
| PubChem CID | 177031342 |
| Molecular Formula | C26H26N2O2ReRf-2 |
| Molecular Weight | 851.71 g/mol |
| Exact Mass | 852.28 |
| IUPAC Name | 1,4-bis(4-tert-butylphenyl)pyrrolo[3,4-c]pyrrole-2,5-diide-3,6-dione;rhenium;rutherfordium |
| SMILES | CC(C)(C)c1ccc(C2=C3C(=O)[N-]C(c4ccc(C(C)(C)C)cc4)=C3C(=O)[N-]2)cc1.[Re].[Rf] |
| InChI | InChI=1S/C26H28N2O2.Re.Rf/c1-25(2,3)17-11-7-15(8-12-17)21-19-20(24(30)27-21)22(28-23(19)29)16-9-13-18(14-10-16)26(4,5)6;;/h7-14H,1-6H3,(H2,27,28,29,30);;/p-2 |
| InChIKey | ABEADOXWIBYGLI-UHFFFAOYSA-L |
| XLogP | 6.23 |
| TPSA | 62.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.71 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|