C8H13NO — CID 177042183
(2S)-2,4-dimethylpentanoyl cyanide (PubChem CID 177042183) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (2S)-2,4-dimethylpentanoyl cyanide.
| Compound Name | (2S)-2,4-dimethylpentanoyl cyanide |
|---|---|
| PubChem CID | 177042183 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (2S)-2,4-dimethylpentanoyl cyanide |
| SMILES | CC(C)C[C@H](C)C(=O)C#N |
| InChI | InChI=1S/C8H13NO/c1-6(2)4-7(3)8(10)5-9/h6-7H,4H2,1-3H3/t7-/m0/s1 |
| InChIKey | ROHUYOHEZNIFEI-ZETCQYMHSA-N |
| XLogP | 1.76 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|