C28H39N5O4 — CID 177054566
4-[[1-[2-[5-(ethenylamino)pentoxy]ethyl]piperidin-4-yl]amino]-2-(6-methylidene-2-oxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 177054566) has the molecular formula C28H39N5O4 and a molecular weight of 509.65 g/mol. Its IUPAC name is 4-[[1-[2-[5-(ethenylamino)pentoxy]ethyl]piperidin-4-yl]amino]-2-(6-methylidene-2-oxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[1-[2-[5-(ethenylamino)pentoxy]ethyl]piperidin-4-yl]amino]-2-(6-methylidene-2-oxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 177054566 |
| Molecular Formula | C28H39N5O4 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | 4-[[1-[2-[5-(ethenylamino)pentoxy]ethyl]piperidin-4-yl]amino]-2-(6-methylidene-2-oxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | C=CNCCCCCOCCN1CCC(Nc2cccc3c2C(=O)N(C2CCC(=C)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C28H39N5O4/c1-3-29-14-5-4-6-18-37-19-17-32-15-12-21(13-16-32)31-23-9-7-8-22-25(23)28(36)33(27(22)35)24-11-10-20(2)30-26(24)34/h3,7-9,21,24,29,31H,1-2,4-6,10-19H2,(H,30,34) |
| InChIKey | IHRCCJBUDDWLDI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|