C23H39F2N — CID 177061057
(2Z,8Z)-2,11-difluoro-6,6,11-trimethyl-7,10-dimethylidene-N,N-dipropyldodeca-2,8-dien-4-amine (PubChem CID 177061057) has the molecular formula C23H39F2N and a molecular weight of 367.57 g/mol. Its IUPAC name is (2Z,8Z)-2,11-difluoro-6,6,11-trimethyl-7,10-dimethylidene-N,N-dipropyldodeca-2,8-dien-4-amine.
| Compound Name | (2Z,8Z)-2,11-difluoro-6,6,11-trimethyl-7,10-dimethylidene-N,N-dipropyldodeca-2,8-dien-4-amine |
|---|---|
| PubChem CID | 177061057 |
| Molecular Formula | C23H39F2N |
| Molecular Weight | 367.57 g/mol |
| Exact Mass | 367.31 |
| IUPAC Name | (2Z,8Z)-2,11-difluoro-6,6,11-trimethyl-7,10-dimethylidene-N,N-dipropyldodeca-2,8-dien-4-amine |
| SMILES | C=C(/C=C\C(=C)C(C)(C)CC(/C=C(/C)F)N(CCC)CCC)C(C)(C)F |
| InChI | InChI=1S/C23H39F2N/c1-10-14-26(15-11-2)21(16-20(5)24)17-22(6,7)18(3)12-13-19(4)23(8,9)25/h12-13,16,21H,3-4,10-11,14-15,17H2,1-2,5-9H3/b13-12-,20-16- |
| InChIKey | MMWBFQABJGSGIK-VOQSRDMCSA-N |
| XLogP | 7.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.57 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|