C34H41N3O5S — CID 177085651
3-[(2E)-2-[(E)-3-[1-(5-carboxypentyl)pyridin-1-ium-4-yl]prop-2-enylidene]-3,3-dimethyl-5-(N-methylanilino)indol-1-yl]propane-1-sulfonate (PubChem CID 177085651) has the molecular formula C34H41N3O5S and a molecular weight of 603.79 g/mol. Its IUPAC name is 3-[(2E)-2-[(E)-3-[1-(5-carboxypentyl)pyridin-1-ium-4-yl]prop-2-enylidene]-3,3-dimethyl-5-(N-methylanilino)indol-1-yl]propane-1-sulfonate.
| Compound Name | 3-[(2E)-2-[(E)-3-[1-(5-carboxypentyl)pyridin-1-ium-4-yl]prop-2-enylidene]-3,3-dimethyl-5-(N-methylanilino)indol-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 177085651 |
| Molecular Formula | C34H41N3O5S |
| Molecular Weight | 603.79 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | 3-[(2E)-2-[(E)-3-[1-(5-carboxypentyl)pyridin-1-ium-4-yl]prop-2-enylidene]-3,3-dimethyl-5-(N-methylanilino)indol-1-yl]propane-1-sulfonate |
| SMILES | CN(c1ccccc1)c1ccc2c(c1)C(C)(C)/C(=C\C=C\c1cc[n+](CCCCCC(=O)O)cc1)N2CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C34H41N3O5S/c1-34(2)30-26-29(35(3)28-13-6-4-7-14-28)17-18-31(30)37(22-11-25-43(40,41)42)32(34)15-10-12-27-19-23-36(24-20-27)21-9-5-8-16-33(38)39/h4,6-7,10,12-15,17-20,23-24,26H,5,8-9,11,16,21-22,25H2,1-3H3,(H-,38,39,40,41,42) |
| InChIKey | QRTGIWZDEOUIFY-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.79 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|