C14H22N2 — CID 177150101
4-tert-butyl-5-ethyl-6-methyl-2,3-dihydro-1H-indazole (PubChem CID 177150101) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 4-tert-butyl-5-ethyl-6-methyl-2,3-dihydro-1H-indazole.
| Compound Name | 4-tert-butyl-5-ethyl-6-methyl-2,3-dihydro-1H-indazole |
|---|---|
| PubChem CID | 177150101 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 4-tert-butyl-5-ethyl-6-methyl-2,3-dihydro-1H-indazole |
| SMILES | CCc1c(C)cc2c(c1C(C)(C)C)CNN2 |
| InChI | InChI=1S/C14H22N2/c1-6-10-9(2)7-12-11(8-15-16-12)13(10)14(3,4)5/h7,15-16H,6,8H2,1-5H3 |
| InChIKey | CMMWARLDTPMIGX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |