C35H42N6O7S — CID 177161264
cyclohexanamine;2-[3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]phenyl]-N-(5-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 177161264) has the molecular formula C35H42N6O7S and a molecular weight of 690.82 g/mol. Its IUPAC name is cyclohexanamine;2-[3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]phenyl]-N-(5-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | cyclohexanamine;2-[3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]phenyl]-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 177161264 |
| Molecular Formula | C35H42N6O7S |
| Molecular Weight | 690.82 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | cyclohexanamine;2-[3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]phenyl]-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1cnc(NC(=O)Cc2cccc(OCCOCCNc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)c2)s1.NC1CCCCC1 |
| InChI | InChI=1S/C29H29N5O7S.C6H13N/c1-17-16-31-29(42-17)33-24(36)15-18-4-2-5-19(14-18)41-13-12-40-11-10-30-21-7-3-6-20-25(21)28(39)34(27(20)38)22-8-9-23(35)32-26(22)37;7-6-4-2-1-3-5-6/h2-7,14,16,22,30H,8-13,15H2,1H3,(H,31,33,36)(H,32,35,37);6H,1-5,7H2 |
| InChIKey | UJOMMHMKUWECTB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 182.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.82 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|