C16H26N2O4S — CID 177169749
tert-butyl 5-[2-[(2-aminothiophene-3-carbonyl)amino]ethoxy]pentanoate (PubChem CID 177169749) has the molecular formula C16H26N2O4S and a molecular weight of 342.46 g/mol. Its IUPAC name is tert-butyl 5-[2-[(2-aminothiophene-3-carbonyl)amino]ethoxy]pentanoate.
| Compound Name | tert-butyl 5-[2-[(2-aminothiophene-3-carbonyl)amino]ethoxy]pentanoate |
|---|---|
| PubChem CID | 177169749 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | tert-butyl 5-[2-[(2-aminothiophene-3-carbonyl)amino]ethoxy]pentanoate |
| SMILES | CC(C)(C)OC(=O)CCCCOCCNC(=O)c1ccsc1N |
| InChI | InChI=1S/C16H26N2O4S/c1-16(2,3)22-13(19)6-4-5-9-21-10-8-18-15(20)12-7-11-23-14(12)17/h7,11H,4-6,8-10,17H2,1-3H3,(H,18,20) |
| InChIKey | QUBVSCCJVYBGGI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|