C7H14N2 — CID 177181824
(1S,4S)-2,3-dimethyl-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 177181824) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is (1S,4S)-2,3-dimethyl-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | (1S,4S)-2,3-dimethyl-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 177181824 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (1S,4S)-2,3-dimethyl-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | CC1[C@@H]2C[C@@H](CN2)N1C |
| InChI | InChI=1S/C7H14N2/c1-5-7-3-6(4-8-7)9(5)2/h5-8H,3-4H2,1-2H3/t5?,6-,7-/m0/s1 |
| InChIKey | HSROSNFSENGBPL-BYRXKDITSA-N |
| XLogP | 0.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |