C16H36 — CID 177204594
3,5-diethyloct-1-ene;ethane (PubChem CID 177204594) has the molecular formula C16H36 and a molecular weight of 228.46 g/mol. Its IUPAC name is 3,5-diethyloct-1-ene;ethane.
| Compound Name | 3,5-diethyloct-1-ene;ethane |
|---|---|
| PubChem CID | 177204594 |
| Molecular Formula | C16H36 |
| Molecular Weight | 228.46 g/mol |
| Exact Mass | 228.28 |
| IUPAC Name | 3,5-diethyloct-1-ene;ethane |
| SMILES | C=CC(CC)CC(CC)CCC.CC.CC |
| InChI | InChI=1S/C12H24.2C2H6/c1-5-9-12(8-4)10-11(6-2)7-3;2*1-2/h6,11-12H,2,5,7-10H2,1,3-4H3;2*1-2H3 |
| InChIKey | UQODVLOAJWONQP-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.46 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|