C34H46NO7+ — CID 177226536
tert-butyl 3-[2-[(10-ethyl-6-methyl-5-azoniaspiro[4.5]decan-8-yl)oxy]-2-oxo-1,1-diphenylethoxy]carbonyloxypropanoate (PubChem CID 177226536) has the molecular formula C34H46NO7+ and a molecular weight of 580.74 g/mol. Its IUPAC name is tert-butyl 3-[2-[(10-ethyl-6-methyl-5-azoniaspiro[4.5]decan-8-yl)oxy]-2-oxo-1,1-diphenylethoxy]carbonyloxypropanoate.
| Compound Name | tert-butyl 3-[2-[(10-ethyl-6-methyl-5-azoniaspiro[4.5]decan-8-yl)oxy]-2-oxo-1,1-diphenylethoxy]carbonyloxypropanoate |
|---|---|
| PubChem CID | 177226536 |
| Molecular Formula | C34H46NO7+ |
| Molecular Weight | 580.74 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | tert-butyl 3-[2-[(10-ethyl-6-methyl-5-azoniaspiro[4.5]decan-8-yl)oxy]-2-oxo-1,1-diphenylethoxy]carbonyloxypropanoate |
| SMILES | CCC1CC(OC(=O)C(OC(=O)OCCC(=O)OC(C)(C)C)(c2ccccc2)c2ccccc2)CC(C)[N+]12CCCC2 |
| InChI | InChI=1S/C34H46NO7/c1-6-28-24-29(23-25(2)35(28)20-13-14-21-35)40-31(37)34(26-15-9-7-10-16-26,27-17-11-8-12-18-27)42-32(38)39-22-19-30(36)41-33(3,4)5/h7-12,15-18,25,28-29H,6,13-14,19-24H2,1-5H3/q+1 |
| InChIKey | PPOOOMFRIPFWMJ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.74 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|