C30H38NO4+ — CID 172567687
(2-oxo-1,1-diphenyl-3-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-ylpropyl) propyl carbonate (PubChem CID 172567687) has the molecular formula C30H38NO4+ and a molecular weight of 476.64 g/mol. Its IUPAC name is (2-oxo-1,1-diphenyl-3-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-ylpropyl) propyl carbonate.
| Compound Name | (2-oxo-1,1-diphenyl-3-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-ylpropyl) propyl carbonate |
|---|---|
| PubChem CID | 172567687 |
| Molecular Formula | C30H38NO4+ |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | (2-oxo-1,1-diphenyl-3-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-ylpropyl) propyl carbonate |
| SMILES | CCCOC(=O)OC(C(=O)CC1CC2CCC(C1)[N+]21CCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H38NO4/c1-2-19-34-29(33)35-30(24-11-5-3-6-12-24,25-13-7-4-8-14-25)28(32)22-23-20-26-15-16-27(21-23)31(26)17-9-10-18-31/h3-8,11-14,23,26-27H,2,9-10,15-22H2,1H3/q+1 |
| InChIKey | HPMQYJALAZDDNF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|