C36H52N2O4+2 — CID 177226630
triethyl-[2-oxo-2-[(2-oxo-1,1-diphenyl-4-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-ylbutoxy)methoxy]ethyl]azanium (PubChem CID 177226630) has the molecular formula C36H52N2O4+2 and a molecular weight of 576.82 g/mol. Its IUPAC name is triethyl-[2-oxo-2-[(2-oxo-1,1-diphenyl-4-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-ylbutoxy)methoxy]ethyl]azanium.
| Compound Name | triethyl-[2-oxo-2-[(2-oxo-1,1-diphenyl-4-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-ylbutoxy)methoxy]ethyl]azanium |
|---|---|
| PubChem CID | 177226630 |
| Molecular Formula | C36H52N2O4+2 |
| Molecular Weight | 576.82 g/mol |
| Exact Mass | 576.39 |
| IUPAC Name | triethyl-[2-oxo-2-[(2-oxo-1,1-diphenyl-4-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-ylbutoxy)methoxy]ethyl]azanium |
| SMILES | CC[N+](CC)(CC)CC(=O)OCOC(C(=O)CCC1CC2CCC(C1)[N+]21CCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H52N2O4/c1-4-37(5-2,6-3)27-35(40)41-28-42-36(30-15-9-7-10-16-30,31-17-11-8-12-18-31)34(39)22-19-29-25-32-20-21-33(26-29)38(32)23-13-14-24-38/h7-12,15-18,29,32-33H,4-6,13-14,19-28H2,1-3H3/q+2 |
| InChIKey | LENBDOCBNFSORV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.82 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|