C29H42NO4S+ — CID 177226421
(10-ethyl-6-methyl-5-azoniaspiro[4.5]decan-8-yl) 2-(methylsulfanylmethoxy)-2,2-diphenylacetate;methanol (PubChem CID 177226421) has the molecular formula C29H42NO4S+ and a molecular weight of 500.73 g/mol. Its IUPAC name is (10-ethyl-6-methyl-5-azoniaspiro[4.5]decan-8-yl) 2-(methylsulfanylmethoxy)-2,2-diphenylacetate;methanol.
| Compound Name | (10-ethyl-6-methyl-5-azoniaspiro[4.5]decan-8-yl) 2-(methylsulfanylmethoxy)-2,2-diphenylacetate;methanol |
|---|---|
| PubChem CID | 177226421 |
| Molecular Formula | C29H42NO4S+ |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | (10-ethyl-6-methyl-5-azoniaspiro[4.5]decan-8-yl) 2-(methylsulfanylmethoxy)-2,2-diphenylacetate;methanol |
| SMILES | CCC1CC(OC(=O)C(OCSC)(c2ccccc2)c2ccccc2)CC(C)[N+]12CCCC2.CO |
| InChI | InChI=1S/C28H38NO3S.CH4O/c1-4-25-20-26(19-22(2)29(25)17-11-12-18-29)32-27(30)28(31-21-33-3,23-13-7-5-8-14-23)24-15-9-6-10-16-24;1-2/h5-10,13-16,22,25-26H,4,11-12,17-21H2,1-3H3;2H,1H3/q+1; |
| InChIKey | GGWRLPHQPIZALC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|