C27H34NO3+ — CID 177225077
(3-ethylspiro[2-azoniabicyclo[2.2.0]hexane-2,1'-azolidin-1-ium]-5-yl) 2-ethoxy-2,2-diphenylacetate (PubChem CID 177225077) has the molecular formula C27H34NO3+ and a molecular weight of 420.57 g/mol. Its IUPAC name is (3-ethylspiro[2-azoniabicyclo[2.2.0]hexane-2,1'-azolidin-1-ium]-5-yl) 2-ethoxy-2,2-diphenylacetate.
| Compound Name | (3-ethylspiro[2-azoniabicyclo[2.2.0]hexane-2,1'-azolidin-1-ium]-5-yl) 2-ethoxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 177225077 |
| Molecular Formula | C27H34NO3+ |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | (3-ethylspiro[2-azoniabicyclo[2.2.0]hexane-2,1'-azolidin-1-ium]-5-yl) 2-ethoxy-2,2-diphenylacetate |
| SMILES | CCOC(C(=O)OC1CC2C1C(CC)[N+]21CCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H34NO3/c1-3-22-25-23(28(22)17-11-12-18-28)19-24(25)31-26(29)27(30-4-2,20-13-7-5-8-14-20)21-15-9-6-10-16-21/h5-10,13-16,22-25H,3-4,11-12,17-19H2,1-2H3/q+1 |
| InChIKey | WZOBPVJQYMDBNO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|