C24H26N2O7 — CID 177229079
(4R,4aR,5aR)-1,10,11,12-tetrahydroxy-4-(oxan-4-ylamino)-3-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 177229079) has the molecular formula C24H26N2O7 and a molecular weight of 454.48 g/mol. Its IUPAC name is (4R,4aR,5aR)-1,10,11,12-tetrahydroxy-4-(oxan-4-ylamino)-3-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aR)-1,10,11,12-tetrahydroxy-4-(oxan-4-ylamino)-3-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229079 |
| Molecular Formula | C24H26N2O7 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (4R,4aR,5aR)-1,10,11,12-tetrahydroxy-4-(oxan-4-ylamino)-3-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)C2=C(O)C3=C(O)c4c(O)cccc4C[C@H]3C[C@H]2[C@@H](NC2CCOCC2)C1=O |
| InChI | InChI=1S/C24H26N2O7/c25-24(32)18-22(30)17-13(19(23(18)31)26-12-4-6-33-7-5-12)9-11-8-10-2-1-3-14(27)15(10)20(28)16(11)21(17)29/h1-3,11-13,19,26-30H,4-9H2,(H2,25,32)/t11-,13+,19+/m0/s1 |
| InChIKey | CPBRETXDMSQJBN-CENXUZMRSA-N |
| XLogP | 1.68 |
| TPSA | 162.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|