C14H16F2N4O3 — CID 177234070
8-(4,4-difluorocyclohexyl)-2,3-dimethyl-5H-pteridine-4,6,7-trione (PubChem CID 177234070) has the molecular formula C14H16F2N4O3 and a molecular weight of 326.30 g/mol. Its IUPAC name is 8-(4,4-difluorocyclohexyl)-2,3-dimethyl-5H-pteridine-4,6,7-trione.
| Compound Name | 8-(4,4-difluorocyclohexyl)-2,3-dimethyl-5H-pteridine-4,6,7-trione |
|---|---|
| PubChem CID | 177234070 |
| Molecular Formula | C14H16F2N4O3 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 8-(4,4-difluorocyclohexyl)-2,3-dimethyl-5H-pteridine-4,6,7-trione |
| SMILES | Cc1nc2c([nH]c(=O)c(=O)n2C2CCC(F)(F)CC2)c(=O)n1C |
| InChI | InChI=1S/C14H16F2N4O3/c1-7-17-10-9(12(22)19(7)2)18-11(21)13(23)20(10)8-3-5-14(15,16)6-4-8/h8H,3-6H2,1-2H3,(H,18,21) |
| InChIKey | MGCDFJXWKDDCGF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|