C16H20NOY- — CID 177235280
2-[(2E,4E,6E)-3-methoxynona-2,4,6-trien-5-yl]-5-methyl-4H-pyridin-4-ide;yttrium (PubChem CID 177235280) has the molecular formula C16H20NOY- and a molecular weight of 331.25 g/mol. Its IUPAC name is 2-[(2E,4E,6E)-3-methoxynona-2,4,6-trien-5-yl]-5-methyl-4H-pyridin-4-ide;yttrium.
| Compound Name | 2-[(2E,4E,6E)-3-methoxynona-2,4,6-trien-5-yl]-5-methyl-4H-pyridin-4-ide;yttrium |
|---|---|
| PubChem CID | 177235280 |
| Molecular Formula | C16H20NOY- |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2-[(2E,4E,6E)-3-methoxynona-2,4,6-trien-5-yl]-5-methyl-4H-pyridin-4-ide;yttrium |
| SMILES | C/C=C(\C=C(/C=C/CC)c1c[c-]c(C)cn1)OC.[Y] |
| InChI | InChI=1S/C16H20NO.Y/c1-5-7-8-14(11-15(6-2)18-4)16-10-9-13(3)12-17-16;/h6-8,10-12H,5H2,1-4H3;/q-1;/b8-7+,14-11+,15-6+; |
| InChIKey | NIZWQGPWRVWJEO-YCSACDCZSA-N |
| XLogP | 4.09 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|