C22H15NO4 — CID 177256342
(2E)-2-(3,4-dimethoxyphenyl)-2-(3-oxobenzo[g][1]benzofuran-2-ylidene)acetonitrile (PubChem CID 177256342) has the molecular formula C22H15NO4 and a molecular weight of 357.37 g/mol. Its IUPAC name is (2E)-2-(3,4-dimethoxyphenyl)-2-(3-oxobenzo[g][1]benzofuran-2-ylidene)acetonitrile.
| Compound Name | (2E)-2-(3,4-dimethoxyphenyl)-2-(3-oxobenzo[g][1]benzofuran-2-ylidene)acetonitrile |
|---|---|
| PubChem CID | 177256342 |
| Molecular Formula | C22H15NO4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (2E)-2-(3,4-dimethoxyphenyl)-2-(3-oxobenzo[g][1]benzofuran-2-ylidene)acetonitrile |
| SMILES | COc1ccc(/C(C#N)=C2\Oc3c(ccc4ccccc34)C2=O)cc1OC |
| InChI | InChI=1S/C22H15NO4/c1-25-18-10-8-14(11-19(18)26-2)17(12-23)22-20(24)16-9-7-13-5-3-4-6-15(13)21(16)27-22/h3-11H,1-2H3/b22-17- |
| InChIKey | FJLCSEKOYPLSPJ-XLNRJJMWSA-N |
| XLogP | 4.37 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|