C22H45F3O6Si3 — CID 177269362
2,4,6-triethyl-2-[3-(oxiran-2-ylmethoxy)propyl]-6-[3-(3,3,3-trifluoropropoxy)propyl]-1,3,5,2,4,6-trioxatrisilecane (PubChem CID 177269362) has the molecular formula C22H45F3O6Si3 and a molecular weight of 546.85 g/mol. Its IUPAC name is 2,4,6-triethyl-2-[3-(oxiran-2-ylmethoxy)propyl]-6-[3-(3,3,3-trifluoropropoxy)propyl]-1,3,5,2,4,6-trioxatrisilecane.
| Compound Name | 2,4,6-triethyl-2-[3-(oxiran-2-ylmethoxy)propyl]-6-[3-(3,3,3-trifluoropropoxy)propyl]-1,3,5,2,4,6-trioxatrisilecane |
|---|---|
| PubChem CID | 177269362 |
| Molecular Formula | C22H45F3O6Si3 |
| Molecular Weight | 546.85 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | 2,4,6-triethyl-2-[3-(oxiran-2-ylmethoxy)propyl]-6-[3-(3,3,3-trifluoropropoxy)propyl]-1,3,5,2,4,6-trioxatrisilecane |
| SMILES | CC[SiH]1O[Si](CC)(CCCOCCC(F)(F)F)CCCCO[Si](CC)(CCCOCC2CO2)O1 |
| InChI | InChI=1S/C22H45F3O6Si3/c1-4-32-30-33(5-2,17-9-12-26-15-11-22(23,24)25)16-8-7-14-29-34(6-3,31-32)18-10-13-27-19-21-20-28-21/h21,32H,4-20H2,1-3H3 |
| InChIKey | XEKLVPUPGURVAB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.85 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|