C20H22O9 — CID 177377527
[(1R,2S,11aS)-9-hydroxy-1-methoxy-1,4,7,10-tetramethyl-3,6-dioxo-2,11a-dihydrobenzo[b][1,4]benzodioxepin-2-yl] methyl carbonate (PubChem CID 177377527) has the molecular formula C20H22O9 and a molecular weight of 406.39 g/mol. Its IUPAC name is [(1R,2S,11aS)-9-hydroxy-1-methoxy-1,4,7,10-tetramethyl-3,6-dioxo-2,11a-dihydrobenzo[b][1,4]benzodioxepin-2-yl] methyl carbonate.
| Compound Name | [(1R,2S,11aS)-9-hydroxy-1-methoxy-1,4,7,10-tetramethyl-3,6-dioxo-2,11a-dihydrobenzo[b][1,4]benzodioxepin-2-yl] methyl carbonate |
|---|---|
| PubChem CID | 177377527 |
| Molecular Formula | C20H22O9 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [(1R,2S,11aS)-9-hydroxy-1-methoxy-1,4,7,10-tetramethyl-3,6-dioxo-2,11a-dihydrobenzo[b][1,4]benzodioxepin-2-yl] methyl carbonate |
| SMILES | COC(=O)O[C@@H]1C(=O)C(C)=C2OC(=O)c3c(C)cc(O)c(C)c3O[C@@H]2[C@@]1(C)OC |
| InChI | InChI=1S/C20H22O9/c1-8-7-11(21)9(2)14-12(8)18(23)28-15-10(3)13(22)16(29-19(24)25-5)20(4,26-6)17(15)27-14/h7,16-17,21H,1-6H3/t16-,17+,20+/m1/s1 |
| InChIKey | AAUDQADXJWOMJL-UWVAXJGDSA-N |
| XLogP | 2.34 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |