C18H18O7 — CID 78162546
2',6-dihydroxy-6'-methoxy-3',4,6',7-tetramethylspiro[1-benzofuran-2,5'-cyclohex-2-ene]-1',3,4'-trione (PubChem CID 78162546) has the molecular formula C18H18O7 and a molecular weight of 346.34 g/mol. Its IUPAC name is 2',6-dihydroxy-6'-methoxy-3',4,6',7-tetramethylspiro[1-benzofuran-2,5'-cyclohex-2-ene]-1',3,4'-trione.
| Compound Name | 2',6-dihydroxy-6'-methoxy-3',4,6',7-tetramethylspiro[1-benzofuran-2,5'-cyclohex-2-ene]-1',3,4'-trione |
|---|---|
| PubChem CID | 78162546 |
| Molecular Formula | C18H18O7 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 2',6-dihydroxy-6'-methoxy-3',4,6',7-tetramethylspiro[1-benzofuran-2,5'-cyclohex-2-ene]-1',3,4'-trione |
| SMILES | COC1(C)C(=O)C(O)=C(C)C(=O)C12Oc1c(C)c(O)cc(C)c1C2=O |
| InChI | InChI=1S/C18H18O7/c1-7-6-10(19)8(2)13-11(7)15(22)18(25-13)14(21)9(3)12(20)16(23)17(18,4)24-5/h6,19-20H,1-5H3 |
| InChIKey | FCFHTOILPAFNFS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|