C20H18N4O6S — CID 177379051
N-(furan-2-ylmethyl)-1-oxido-N-[2-(4-sulfamoylphenyl)ethyl]-2,1,3-benzoxadiazol-1-ium-5-carboxamide (PubChem CID 177379051) has the molecular formula C20H18N4O6S and a molecular weight of 442.45 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-oxido-N-[2-(4-sulfamoylphenyl)ethyl]-2,1,3-benzoxadiazol-1-ium-5-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1-oxido-N-[2-(4-sulfamoylphenyl)ethyl]-2,1,3-benzoxadiazol-1-ium-5-carboxamide |
|---|---|
| PubChem CID | 177379051 |
| Molecular Formula | C20H18N4O6S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-oxido-N-[2-(4-sulfamoylphenyl)ethyl]-2,1,3-benzoxadiazol-1-ium-5-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCN(Cc2ccco2)C(=O)c2ccc3c(c2)no[n+]3[O-])cc1 |
| InChI | InChI=1S/C20H18N4O6S/c21-31(27,28)17-6-3-14(4-7-17)9-10-23(13-16-2-1-11-29-16)20(25)15-5-8-19-18(12-15)22-30-24(19)26/h1-8,11-12H,9-10,13H2,(H2,21,27,28) |
| InChIKey | LXCQFPLXZUKPCR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 146.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|