C25H48O2Sn — CID 177385736
[(3Z,3aR,4R,7aR)-3a,5,5-trimethyl-3-(tributylstannylmethylidene)-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]methanol (PubChem CID 177385736) has the molecular formula C25H48O2Sn and a molecular weight of 499.37 g/mol. Its IUPAC name is [(3Z,3aR,4R,7aR)-3a,5,5-trimethyl-3-(tributylstannylmethylidene)-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]methanol.
| Compound Name | [(3Z,3aR,4R,7aR)-3a,5,5-trimethyl-3-(tributylstannylmethylidene)-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]methanol |
|---|---|
| PubChem CID | 177385736 |
| Molecular Formula | C25H48O2Sn |
| Molecular Weight | 499.37 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | [(3Z,3aR,4R,7aR)-3a,5,5-trimethyl-3-(tributylstannylmethylidene)-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]methanol |
| SMILES | CCCC[Sn](/C=C1\CO[C@@H]2CCC(C)(C)[C@@H](CO)[C@]12C)(CCCC)CCCC |
| InChI | InChI=1S/C13H21O2.3C4H9.Sn/c1-9-8-15-11-5-6-12(2,3)10(7-14)13(9,11)4;3*1-3-4-2;/h1,10-11,14H,5-8H2,2-4H3;3*1,3-4H2,2H3;/t10-,11-,13+;;;;/m1..../s1 |
| InChIKey | MYHIGCFYGQHGKF-JCIKITPPSA-N |
| XLogP | 7.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.37 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |