C20H19NO3SSe2 — CID 177396294
3-[3,5-bis(phenylselanyl)pyridin-1-ium-1-yl]propane-1-sulfonate (PubChem CID 177396294) has the molecular formula C20H19NO3SSe2 and a molecular weight of 511.36 g/mol. Its IUPAC name is 3-[3,5-bis(phenylselanyl)pyridin-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[3,5-bis(phenylselanyl)pyridin-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 177396294 |
| Molecular Formula | C20H19NO3SSe2 |
| Molecular Weight | 511.36 g/mol |
| Exact Mass | 512.94 |
| IUPAC Name | 3-[3,5-bis(phenylselanyl)pyridin-1-ium-1-yl]propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCC[n+]1cc([Se]c2ccccc2)cc([Se]c2ccccc2)c1 |
| InChI | InChI=1S/C20H19NO3SSe2/c22-25(23,24)13-7-12-21-15-19(26-17-8-3-1-4-9-17)14-20(16-21)27-18-10-5-2-6-11-18/h1-6,8-11,14-16H,7,12-13H2 |
| InChIKey | DMRTWNFLPGEXOC-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.36 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|