C32H28N4O2 — CID 177411650
1-[(12Z)-12-(1-hydroxyethylidene)-7,7-dimethyl-15-phenyl-8,22-dihydroporphyrin-2-yl]ethanone (PubChem CID 177411650) has the molecular formula C32H28N4O2 and a molecular weight of 500.60 g/mol. Its IUPAC name is 1-[(12Z)-12-(1-hydroxyethylidene)-7,7-dimethyl-15-phenyl-8,22-dihydroporphyrin-2-yl]ethanone.
| Compound Name | 1-[(12Z)-12-(1-hydroxyethylidene)-7,7-dimethyl-15-phenyl-8,22-dihydroporphyrin-2-yl]ethanone |
|---|---|
| PubChem CID | 177411650 |
| Molecular Formula | C32H28N4O2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 1-[(12Z)-12-(1-hydroxyethylidene)-7,7-dimethyl-15-phenyl-8,22-dihydroporphyrin-2-yl]ethanone |
| SMILES | CC(=O)C1=CC2=N/C1=C\C1=N/C(=C(/c3ccccc3)C3=C/C(=C(\C)O)C(=N3)/C=C3/CC(C)(C)/C(=C/2)N3)C=C1 |
| InChI | InChI=1S/C32H28N4O2/c1-18(37)24-12-22-15-30-32(3,4)17-23(35-30)14-28-25(19(2)38)16-29(36-28)31(20-8-6-5-7-9-20)26-11-10-21(33-26)13-27(24)34-22/h5-16,35,38H,17H2,1-4H3/b23-14-,25-19-,27-13-,30-15-,31-26- |
| InChIKey | FEBZOQRJCQUHCL-PLCUUPBCSA-N |
| XLogP | 6.23 |
| TPSA | 86.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|