C34H24S2 — CID 177413114
(5Z)-2-benzhydrylidene-5-(5-benzhydrylidenethiophen-2-ylidene)thiophene (PubChem CID 177413114) has the molecular formula C34H24S2 and a molecular weight of 496.70 g/mol. Its IUPAC name is (5Z)-2-benzhydrylidene-5-(5-benzhydrylidenethiophen-2-ylidene)thiophene.
| Compound Name | (5Z)-2-benzhydrylidene-5-(5-benzhydrylidenethiophen-2-ylidene)thiophene |
|---|---|
| PubChem CID | 177413114 |
| Molecular Formula | C34H24S2 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | (5Z)-2-benzhydrylidene-5-(5-benzhydrylidenethiophen-2-ylidene)thiophene |
| SMILES | c1ccc(C(c2ccccc2)=c2cc/c(=c3\ccc(=C(c4ccccc4)c4ccccc4)s3)s2)cc1 |
| InChI | InChI=1S/C34H24S2/c1-5-13-25(14-6-1)33(26-15-7-2-8-16-26)31-23-21-29(35-31)30-22-24-32(36-30)34(27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-24H/b30-29- |
| InChIKey | YUUJGCIWBUOFEO-FLWNBWAVSA-N |
| XLogP | 7.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |