C18H10N4S2 — CID 10521524
7-benzhydrylidene-4,10-dithia-3,5,9,11-tetrazatricyclo[6.3.0.02,6]undeca-1(11),2,5,8-tetraene (PubChem CID 10521524) has the molecular formula C18H10N4S2 and a molecular weight of 346.44 g/mol. Its IUPAC name is 7-benzhydrylidene-4,10-dithia-3,5,9,11-tetrazatricyclo[6.3.0.02,6]undeca-1(11),2,5,8-tetraene.
| Compound Name | 7-benzhydrylidene-4,10-dithia-3,5,9,11-tetrazatricyclo[6.3.0.02,6]undeca-1(11),2,5,8-tetraene |
|---|---|
| PubChem CID | 10521524 |
| Molecular Formula | C18H10N4S2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 7-benzhydrylidene-4,10-dithia-3,5,9,11-tetrazatricyclo[6.3.0.02,6]undeca-1(11),2,5,8-tetraene |
| SMILES | c1ccc(C(=C2c3nsnc3-c3nsnc32)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H10N4S2/c1-3-7-11(8-4-1)13(12-9-5-2-6-10-12)14-15-17(21-23-19-15)18-16(14)20-24-22-18/h1-10H |
| InChIKey | WFSWFUMIWWIJET-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |