C54H54N4 — CID 177421796
(2R,4R,5R)-1-benzyl-2-[3-[(2R,4R,5R)-1-benzyl-4,5-diphenylimidazolidin-2-yl]-5-tert-butylphenyl]-4,5-diphenylimidazolidine (PubChem CID 177421796) has the molecular formula C54H54N4 and a molecular weight of 759.05 g/mol. Its IUPAC name is (2R,4R,5R)-1-benzyl-2-[3-[(2R,4R,5R)-1-benzyl-4,5-diphenylimidazolidin-2-yl]-5-tert-butylphenyl]-4,5-diphenylimidazolidine.
| Compound Name | (2R,4R,5R)-1-benzyl-2-[3-[(2R,4R,5R)-1-benzyl-4,5-diphenylimidazolidin-2-yl]-5-tert-butylphenyl]-4,5-diphenylimidazolidine |
|---|---|
| PubChem CID | 177421796 |
| Molecular Formula | C54H54N4 |
| Molecular Weight | 759.05 g/mol |
| Exact Mass | 758.43 |
| IUPAC Name | (2R,4R,5R)-1-benzyl-2-[3-[(2R,4R,5R)-1-benzyl-4,5-diphenylimidazolidin-2-yl]-5-tert-butylphenyl]-4,5-diphenylimidazolidine |
| SMILES | CC(C)(C)c1cc([C@@H]2N[C@H](c3ccccc3)[C@@H](c3ccccc3)N2Cc2ccccc2)cc([C@@H]2N[C@H](c3ccccc3)[C@@H](c3ccccc3)N2Cc2ccccc2)c1 |
| InChI | InChI=1S/C54H54N4/c1-54(2,3)47-35-45(52-55-48(41-26-14-6-15-27-41)50(43-30-18-8-19-31-43)57(52)37-39-22-10-4-11-23-39)34-46(36-47)53-56-49(42-28-16-7-17-29-42)51(44-32-20-9-21-33-44)58(53)38-40-24-12-5-13-25-40/h4-36,48-53,55-56H,37-38H2,1-3H3/t48-,49-,50-,51-,52-,53-/m1/s1 |
| InChIKey | UGLWXKBRVDFSCB-BVYMUKDBSA-N |
| XLogP | 12.16 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.05 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |