C19H25NO6 — CID 177423120
[(E)-(2,4,6-trimethoxyphenyl)methylideneamino] 3-cyclohex-2-en-1-yloxypropanoate (PubChem CID 177423120) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is [(E)-(2,4,6-trimethoxyphenyl)methylideneamino] 3-cyclohex-2-en-1-yloxypropanoate.
| Compound Name | [(E)-(2,4,6-trimethoxyphenyl)methylideneamino] 3-cyclohex-2-en-1-yloxypropanoate |
|---|---|
| PubChem CID | 177423120 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | [(E)-(2,4,6-trimethoxyphenyl)methylideneamino] 3-cyclohex-2-en-1-yloxypropanoate |
| SMILES | COc1cc(OC)c(/C=N/OC(=O)CCOC2C=CCCC2)c(OC)c1 |
| InChI | InChI=1S/C19H25NO6/c1-22-15-11-17(23-2)16(18(12-15)24-3)13-20-26-19(21)9-10-25-14-7-5-4-6-8-14/h5,7,11-14H,4,6,8-10H2,1-3H3/b20-13+ |
| InChIKey | HQDZZMZZUGXMMQ-DEDYPNTBSA-N |
| XLogP | 3.10 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|