C18H23NO5 — CID 10735395
[(Z)-(2,4-dimethoxyphenyl)methylideneamino] 3-cyclohex-2-en-1-yloxypropanoate (PubChem CID 10735395) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is [(Z)-(2,4-dimethoxyphenyl)methylideneamino] 3-cyclohex-2-en-1-yloxypropanoate.
| Compound Name | [(Z)-(2,4-dimethoxyphenyl)methylideneamino] 3-cyclohex-2-en-1-yloxypropanoate |
|---|---|
| PubChem CID | 10735395 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [(Z)-(2,4-dimethoxyphenyl)methylideneamino] 3-cyclohex-2-en-1-yloxypropanoate |
| SMILES | COc1ccc(/C=N\OC(=O)CCOC2C=CCCC2)c(OC)c1 |
| InChI | InChI=1S/C18H23NO5/c1-21-16-9-8-14(17(12-16)22-2)13-19-24-18(20)10-11-23-15-6-4-3-5-7-15/h4,6,8-9,12-13,15H,3,5,7,10-11H2,1-2H3/b19-13- |
| InChIKey | HTMOAENHBSTRJL-UYRXBGFRSA-N |
| XLogP | 3.10 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|