C24H35N7O8 — CID 177430616
methyl (2S,7E,10S)-10-[[(2S,7E,10S)-10-amino-2-methyl-3,11-dioxo-1,4-diazacycloundec-7-ene-5-carbonyl]amino]-2-(2-amino-2-oxoethyl)-3,11-dioxo-1,4-diazacycloundec-7-ene-5-carboxylate (PubChem CID 177430616) has the molecular formula C24H35N7O8 and a molecular weight of 549.59 g/mol. Its IUPAC name is methyl (2S,7E,10S)-10-[[(2S,7E,10S)-10-amino-2-methyl-3,11-dioxo-1,4-diazacycloundec-7-ene-5-carbonyl]amino]-2-(2-amino-2-oxoethyl)-3,11-dioxo-1,4-diazacycloundec-7-ene-5-carboxylate.
| Compound Name | methyl (2S,7E,10S)-10-[[(2S,7E,10S)-10-amino-2-methyl-3,11-dioxo-1,4-diazacycloundec-7-ene-5-carbonyl]amino]-2-(2-amino-2-oxoethyl)-3,11-dioxo-1,4-diazacycloundec-7-ene-5-carboxylate |
|---|---|
| PubChem CID | 177430616 |
| Molecular Formula | C24H35N7O8 |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | methyl (2S,7E,10S)-10-[[(2S,7E,10S)-10-amino-2-methyl-3,11-dioxo-1,4-diazacycloundec-7-ene-5-carbonyl]amino]-2-(2-amino-2-oxoethyl)-3,11-dioxo-1,4-diazacycloundec-7-ene-5-carboxylate |
| SMILES | COC(=O)C1C/C=C/C[C@H](NC(=O)C2C/C=C/C[C@H](N)C(=O)N[C@@H](C)C(=O)N2)C(=O)N[C@@H](CC(N)=O)C(=O)N1 |
| InChI | InChI=1S/C24H35N7O8/c1-12-19(33)28-14(8-4-3-7-13(25)20(34)27-12)21(35)29-15-9-5-6-10-16(24(38)39-2)30-23(37)17(11-18(26)32)31-22(15)36/h3-6,12-17H,7-11,25H2,1-2H3,(H2,26,32)(H,27,34)(H,28,33)(H,29,35)(H,30,37)(H,31,36)/b4-3+,6-5+/t12-,13-,14?,15-,16?,17-/m0/s1 |
| InChIKey | GEXBJRJMBOFZET-KBCDXTKCSA-N |
| XLogP | -3.49 |
| TPSA | 240.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|