C31H44O2Si — CID 177437086
1-[(1R,3aR,4R,7aS)-4-[tert-butyl(diphenyl)silyl]oxy-3a-methyl-7-methylidene-2,3,4,5,6,7a-hexahydro-1H-inden-1-yl]-2-methylpropan-2-ol (PubChem CID 177437086) has the molecular formula C31H44O2Si and a molecular weight of 476.78 g/mol. Its IUPAC name is 1-[(1R,3aR,4R,7aS)-4-[tert-butyl(diphenyl)silyl]oxy-3a-methyl-7-methylidene-2,3,4,5,6,7a-hexahydro-1H-inden-1-yl]-2-methylpropan-2-ol.
| Compound Name | 1-[(1R,3aR,4R,7aS)-4-[tert-butyl(diphenyl)silyl]oxy-3a-methyl-7-methylidene-2,3,4,5,6,7a-hexahydro-1H-inden-1-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 177437086 |
| Molecular Formula | C31H44O2Si |
| Molecular Weight | 476.78 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | 1-[(1R,3aR,4R,7aS)-4-[tert-butyl(diphenyl)silyl]oxy-3a-methyl-7-methylidene-2,3,4,5,6,7a-hexahydro-1H-inden-1-yl]-2-methylpropan-2-ol |
| SMILES | C=C1CC[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@]2(C)CC[C@H](CC(C)(C)O)[C@@H]12 |
| InChI | InChI=1S/C31H44O2Si/c1-23-18-19-27(31(7)21-20-24(28(23)31)22-30(5,6)32)33-34(29(2,3)4,25-14-10-8-11-15-25)26-16-12-9-13-17-26/h8-17,24,27-28,32H,1,18-22H2,2-7H3/t24-,27-,28-,31+/m1/s1 |
| InChIKey | FGPJJOBQDKLWNW-AUSJPMGCSA-N |
| XLogP | 6.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.78 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|