C36H38N4 — CID 177445707
3,7,13,17-tetrakis(ethenyl)-2,8,12,18-tetraethyl-21,22-dihydroporphyrin (PubChem CID 177445707) has the molecular formula C36H38N4 and a molecular weight of 526.73 g/mol. Its IUPAC name is 3,7,13,17-tetrakis(ethenyl)-2,8,12,18-tetraethyl-21,22-dihydroporphyrin.
| Compound Name | 3,7,13,17-tetrakis(ethenyl)-2,8,12,18-tetraethyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 177445707 |
| Molecular Formula | C36H38N4 |
| Molecular Weight | 526.73 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | 3,7,13,17-tetrakis(ethenyl)-2,8,12,18-tetraethyl-21,22-dihydroporphyrin |
| SMILES | C=CC1=C(CC)c2cc3[nH]c(cc4[nH]c(cc5nc(cc1n2)C(C=C)=C5CC)c(CC)c4C=C)c(C=C)c3CC |
| InChI | InChI=1S/C36H38N4/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30/h9,11,14,16-20,37-38H,1,3,6,8,10,12-13,15H2,2,4-5,7H3/b29-17-,30-18-,31-17-,32-18-,33-19-,34-20-,35-19-,36-20- |
| InChIKey | ZUHPPPACILCLNG-MUZKIALCSA-N |
| XLogP | 9.74 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.73 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |