C25H42O6Si — CID 177448197
ethyl (E,8E)-8-[(5Z)-5-[2-[tert-butyl(dimethyl)silyl]oxypropylidene]-2,2-dimethyl-6-oxo-1,3-dioxan-4-ylidene]oct-2-enoate (PubChem CID 177448197) has the molecular formula C25H42O6Si and a molecular weight of 466.69 g/mol. Its IUPAC name is ethyl (E,8E)-8-[(5Z)-5-[2-[tert-butyl(dimethyl)silyl]oxypropylidene]-2,2-dimethyl-6-oxo-1,3-dioxan-4-ylidene]oct-2-enoate.
| Compound Name | ethyl (E,8E)-8-[(5Z)-5-[2-[tert-butyl(dimethyl)silyl]oxypropylidene]-2,2-dimethyl-6-oxo-1,3-dioxan-4-ylidene]oct-2-enoate |
|---|---|
| PubChem CID | 177448197 |
| Molecular Formula | C25H42O6Si |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | ethyl (E,8E)-8-[(5Z)-5-[2-[tert-butyl(dimethyl)silyl]oxypropylidene]-2,2-dimethyl-6-oxo-1,3-dioxan-4-ylidene]oct-2-enoate |
| SMILES | CCOC(=O)/C=C/CCCC/C=C1/OC(C)(C)OC(=O)/C1=C\C(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H42O6Si/c1-10-28-22(26)17-15-13-11-12-14-16-21-20(23(27)30-25(6,7)29-21)18-19(2)31-32(8,9)24(3,4)5/h15-19H,10-14H2,1-9H3/b17-15+,20-18-,21-16+ |
| InChIKey | RCVDTHBHKSLUIO-GCVJCHLXSA-N |
| XLogP | 6.20 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|