About CID 177451291
CID 177451291 (PubChem CID 177451291) has the molecular formula C57H79ClSi2Sn
and a molecular weight of 974.59 g/mol.
Molecular Properties
| Compound Name | CID 177451291 |
| PubChem CID | 177451291 |
| Molecular Formula | C57H79ClSi2Sn |
| Molecular Weight | 974.59 g/mol |
| Exact Mass | 974.44 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(C(C)C)c([Si](Cl)[Si](c2c(C(C)C)cc(C(C)C)cc2C(C)C)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C(C)C)c1.c1ccc([Sn]c2ccccc2)cc1 |
| InChI | InChI=1S/C45H69ClSi2.2C6H5.Sn/c1-25(2)34-19-37(28(7)8)43(38(20-34)29(9)10)47(44-39(30(11)12)21-35(26(3)4)22-40(44)31(13)14)48(46)45-41(32(15)16)23-36(27(5)6)24-42(45)33(17)18;2*1-2-4-6-5-3-1;/h19-33H,1-18H3;2*1-5H; |
| InChIKey | BVKFNNQCQKOBRU-UHFFFAOYSA-N |
| XLogP | 13.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 974.59 |
| LogP ≤ 5 | 13.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 177451291 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177451291?
The IUPAC name of CID 177451291 (CID 177451291) is not available.
What is the SMILES notation for CID 177451291?
The canonical SMILES for CID 177451291 is CC(C)c1cc(C(C)C)c([Si](Cl)[Si](c2c(C(C)C)cc(C(C)C)cc2C(C)C)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C(C)C)c1.c1ccc([Sn]c2ccccc2)cc1.
What is the InChIKey of CID 177451291?
The InChIKey is BVKFNNQCQKOBRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H69ClSi2.2C6H5.Sn/c1-25(2)34-19-37(28(7)8)43(38(20-34)29(9)10)47(44-39(30(11)12)21-35(26(3)4)22-40(44)31(13)14)48(46)45-41(32(15)16)23-36(27(5)6)24-42(45)33(17)18;2*1-2-4-6-5-3-1;/h19-33H,1-18H3;2*1-5H;.
What are the key properties of CID 177451291?
CID 177451291 has a molecular weight of 974.59 g/mol, XLogP of 13.96, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177451291 is sourced from PubChem (CID 177451291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).