C57H79ClSi3 — CID 24851166
1-chloro-2,2-diphenyl-1,3,3-tris[2,4,6-tri(propan-2-yl)phenyl]trisilirane (PubChem CID 24851166) has the molecular formula C57H79ClSi3 and a molecular weight of 883.97 g/mol. Its IUPAC name is 1-chloro-2,2-diphenyl-1,3,3-tris[2,4,6-tri(propan-2-yl)phenyl]trisilirane.
| Compound Name | 1-chloro-2,2-diphenyl-1,3,3-tris[2,4,6-tri(propan-2-yl)phenyl]trisilirane |
|---|---|
| PubChem CID | 24851166 |
| Molecular Formula | C57H79ClSi3 |
| Molecular Weight | 883.97 g/mol |
| Exact Mass | 882.52 |
| IUPAC Name | 1-chloro-2,2-diphenyl-1,3,3-tris[2,4,6-tri(propan-2-yl)phenyl]trisilirane |
| SMILES | CC(C)c1cc(C(C)C)c([Si]2(Cl)[Si](c3ccccc3)(c3ccccc3)[Si]2(c2c(C(C)C)cc(C(C)C)cc2C(C)C)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C57H79ClSi3/c1-35(2)44-29-49(38(7)8)55(50(30-44)39(9)10)60(56-51(40(11)12)31-45(36(3)4)32-52(56)41(13)14)59(47-25-21-19-22-26-47,48-27-23-20-24-28-48)61(60,58)57-53(42(15)16)33-46(37(5)6)34-54(57)43(17)18/h19-43H,1-18H3 |
| InChIKey | JXAJZJYNWJLSJY-UHFFFAOYSA-N |
| XLogP | 13.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.97 |
| LogP ≤ 5 | 13.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|