C47H75ClSi3 — CID 139116981
(1S)-1-chloro-2,2-dimethyl-1,3,3-tris[2,4,6-tri(propan-2-yl)phenyl]trisilirane (PubChem CID 139116981) has the molecular formula C47H75ClSi3 and a molecular weight of 759.83 g/mol. Its IUPAC name is (1S)-1-chloro-2,2-dimethyl-1,3,3-tris[2,4,6-tri(propan-2-yl)phenyl]trisilirane.
| Compound Name | (1S)-1-chloro-2,2-dimethyl-1,3,3-tris[2,4,6-tri(propan-2-yl)phenyl]trisilirane |
|---|---|
| PubChem CID | 139116981 |
| Molecular Formula | C47H75ClSi3 |
| Molecular Weight | 759.83 g/mol |
| Exact Mass | 758.49 |
| IUPAC Name | (1S)-1-chloro-2,2-dimethyl-1,3,3-tris[2,4,6-tri(propan-2-yl)phenyl]trisilirane |
| SMILES | CC(C)c1cc(C(C)C)c([Si]2(c3c(C(C)C)cc(C(C)C)cc3C(C)C)[Si](C)(C)[Si@@]2(Cl)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C47H75ClSi3/c1-27(2)36-21-39(30(7)8)45(40(22-36)31(9)10)50(46-41(32(11)12)23-37(28(3)4)24-42(46)33(13)14)49(19,20)51(50,48)47-43(34(15)16)25-38(29(5)6)26-44(47)35(17)18/h21-35H,1-20H3/t51-/m0/s1 |
| InChIKey | WYYWGKNDYONRHR-XHIZWQFQSA-N |
| XLogP | 13.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.83 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|