C21H19N7S — CID 177452260
4-amino-3-[(2E)-2-[[4-(N-phenylanilino)phenyl]methylidene]hydrazinyl]-1H-1,2,4-triazole-5-thione (PubChem CID 177452260) has the molecular formula C21H19N7S and a molecular weight of 401.50 g/mol. Its IUPAC name is 4-amino-3-[(2E)-2-[[4-(N-phenylanilino)phenyl]methylidene]hydrazinyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-[(2E)-2-[[4-(N-phenylanilino)phenyl]methylidene]hydrazinyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 177452260 |
| Molecular Formula | C21H19N7S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-amino-3-[(2E)-2-[[4-(N-phenylanilino)phenyl]methylidene]hydrazinyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Nn1c(N/N=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)n[nH]c1=S |
| InChI | InChI=1S/C21H19N7S/c22-28-20(25-26-21(28)29)24-23-15-16-11-13-19(14-12-16)27(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-15H,22H2,(H,24,25)(H,26,29)/b23-15+ |
| InChIKey | BMGTZFTZQSKFOL-HZHRSRAPSA-N |
| XLogP | 4.57 |
| TPSA | 87.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|