C8H19N2O3+ — CID 177466837
2,3-dihydroxypropyl-dimethyl-(propanoylamino)azanium (PubChem CID 177466837) has the molecular formula C8H19N2O3+ and a molecular weight of 191.25 g/mol. Its IUPAC name is 2,3-dihydroxypropyl-dimethyl-(propanoylamino)azanium.
| Compound Name | 2,3-dihydroxypropyl-dimethyl-(propanoylamino)azanium |
|---|---|
| PubChem CID | 177466837 |
| Molecular Formula | C8H19N2O3+ |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 2,3-dihydroxypropyl-dimethyl-(propanoylamino)azanium |
| SMILES | CCC(=O)N[N+](C)(C)CC(O)CO |
| InChI | InChI=1S/C8H18N2O3/c1-4-8(13)9-10(2,3)5-7(12)6-11/h7,11-12H,4-6H2,1-3H3/p+1 |
| InChIKey | DROPCBIBWWSBAK-UHFFFAOYSA-O |
| XLogP | -1.14 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|