C7H17NO3 — CID 139123683
(2S)-N,N-diethyl-2,3-dihydroxypropan-1-amine oxide (PubChem CID 139123683) has the molecular formula C7H17NO3 and a molecular weight of 163.22 g/mol. Its IUPAC name is (2S)-N,N-diethyl-2,3-dihydroxypropan-1-amine oxide.
| Compound Name | (2S)-N,N-diethyl-2,3-dihydroxypropan-1-amine oxide |
|---|---|
| PubChem CID | 139123683 |
| Molecular Formula | C7H17NO3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | (2S)-N,N-diethyl-2,3-dihydroxypropan-1-amine oxide |
| SMILES | CC[N+]([O-])(CC)C[C@H](O)CO |
| InChI | InChI=1S/C7H17NO3/c1-3-8(11,4-2)5-7(10)6-9/h7,9-10H,3-6H2,1-2H3/t7-/m0/s1 |
| InChIKey | GOMLUUNDSRTIJI-ZETCQYMHSA-N |
| XLogP | -0.31 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|