C66H39N3O12 — CID 177491985
tris[2-oxo-2-[(7-oxobenzo[a]phenalen-3-yl)amino]ethyl] benzene-1,3,5-tricarboxylate (PubChem CID 177491985) has the molecular formula C66H39N3O12 and a molecular weight of 1066.05 g/mol. Its IUPAC name is tris[2-oxo-2-[(7-oxobenzo[a]phenalen-3-yl)amino]ethyl] benzene-1,3,5-tricarboxylate.
| Compound Name | tris[2-oxo-2-[(7-oxobenzo[a]phenalen-3-yl)amino]ethyl] benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 177491985 |
| Molecular Formula | C66H39N3O12 |
| Molecular Weight | 1066.05 g/mol |
| Exact Mass | 1065.25 |
| IUPAC Name | tris[2-oxo-2-[(7-oxobenzo[a]phenalen-3-yl)amino]ethyl] benzene-1,3,5-tricarboxylate |
| SMILES | O=C(COC(=O)c1cc(C(=O)OCC(=O)Nc2ccc3c4c(cccc24)C(=O)c2ccccc2-3)cc(C(=O)OCC(=O)Nc2ccc3c4c(cccc24)C(=O)c2ccccc2-3)c1)Nc1ccc2c3c(cccc13)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C66H39N3O12/c70-55(67-52-25-22-40-37-10-1-4-13-43(37)61(73)49-19-7-16-46(52)58(40)49)31-79-64(76)34-28-35(65(77)80-32-56(71)68-53-26-23-41-38-11-2-5-14-44(38)62(74)50-20-8-17-47(53)59(41)50)30-36(29-34)66(78)81-33-57(72)69-54-27-24-42-39-12-3-6-15-45(39)63(75)51-21-9-18-48(54)60(42)51/h1-30H,31-33H2,(H,67,70)(H,68,71)(H,69,72) |
| InChIKey | MDDOPTWSCKKZGH-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 217.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1066.05 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|