C8H9OP — CID 178006597
1-methyl-3H-2,1-benzoxaphosphole (PubChem CID 178006597) has the molecular formula C8H9OP and a molecular weight of 152.13 g/mol. Its IUPAC name is 1-methyl-3H-2,1-benzoxaphosphole.
| Compound Name | 1-methyl-3H-2,1-benzoxaphosphole |
|---|---|
| PubChem CID | 178006597 |
| Molecular Formula | C8H9OP |
| Molecular Weight | 152.13 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 1-methyl-3H-2,1-benzoxaphosphole |
| SMILES | CP1OCc2ccccc21 |
| InChI | InChI=1S/C8H9OP/c1-10-8-5-3-2-4-7(8)6-9-10/h2-5H,6H2,1H3 |
| InChIKey | CRLZYINGUQLDTO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.13 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|